C36H41NO8 — CID 70230604
(2S)-2-[[4-[7-(1-adamantyl)-6-(2-methoxyethoxymethoxy)naphthalen-2-yl]benzoyl]amino]pentanedioic acid (PubChem CID 70230604) has the molecular formula C36H41NO8 and a molecular weight of 615.72 g/mol. Its IUPAC name is (2S)-2-[[4-[7-(1-adamantyl)-6-(2-methoxyethoxymethoxy)naphthalen-2-yl]benzoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[4-[7-(1-adamantyl)-6-(2-methoxyethoxymethoxy)naphthalen-2-yl]benzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 70230604 |
| Molecular Formula | C36H41NO8 |
| Molecular Weight | 615.72 g/mol |
| Exact Mass | 615.28 |
| IUPAC Name | (2S)-2-[[4-[7-(1-adamantyl)-6-(2-methoxyethoxymethoxy)naphthalen-2-yl]benzoyl]amino]pentanedioic acid |
| SMILES | COCCOCOc1cc2ccc(-c3ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc3)cc2cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C36H41NO8/c1-43-10-11-44-21-45-32-17-28-7-6-27(15-29(28)16-30(32)36-18-22-12-23(19-36)14-24(13-22)20-36)25-2-4-26(5-3-25)34(40)37-31(35(41)42)8-9-33(38)39/h2-7,15-17,22-24,31H,8-14,18-21H2,1H3,(H,37,40)(H,38,39)(H,41,42)/t22?,23?,24?,31-,36?/m0/s1 |
| InChIKey | MSXJQXNAHAUKDE-MFGGKWOPSA-N |
| XLogP | 6.02 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.72 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|