C30H34O6 — CID 67584306
4-[3-[4-(1-adamantyl)-3-(2-methoxyethoxymethoxy)phenyl]-3-hydroxyprop-1-ynyl]benzoic acid (PubChem CID 67584306) has the molecular formula C30H34O6 and a molecular weight of 490.60 g/mol. Its IUPAC name is 4-[3-[4-(1-adamantyl)-3-(2-methoxyethoxymethoxy)phenyl]-3-hydroxyprop-1-ynyl]benzoic acid.
| Compound Name | 4-[3-[4-(1-adamantyl)-3-(2-methoxyethoxymethoxy)phenyl]-3-hydroxyprop-1-ynyl]benzoic acid |
|---|---|
| PubChem CID | 67584306 |
| Molecular Formula | C30H34O6 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 4-[3-[4-(1-adamantyl)-3-(2-methoxyethoxymethoxy)phenyl]-3-hydroxyprop-1-ynyl]benzoic acid |
| SMILES | COCCOCOc1cc(C(O)C#Cc2ccc(C(=O)O)cc2)ccc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C30H34O6/c1-34-10-11-35-19-36-28-15-25(27(31)9-4-20-2-5-24(6-3-20)29(32)33)7-8-26(28)30-16-21-12-22(17-30)14-23(13-21)18-30/h2-3,5-8,15,21-23,27,31H,10-14,16-19H2,1H3,(H,32,33) |
| InChIKey | PNIKXIHXYFQZCJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|