C36H46O7 — CID 25053551
4-[(E)-3-[5-(1-adamantyl)-2-hexoxy-4-(2-methoxyethoxymethoxy)phenyl]-3-oxoprop-1-enyl]benzoic acid (PubChem CID 25053551) has the molecular formula C36H46O7 and a molecular weight of 590.76 g/mol. Its IUPAC name is 4-[(E)-3-[5-(1-adamantyl)-2-hexoxy-4-(2-methoxyethoxymethoxy)phenyl]-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 4-[(E)-3-[5-(1-adamantyl)-2-hexoxy-4-(2-methoxyethoxymethoxy)phenyl]-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 25053551 |
| Molecular Formula | C36H46O7 |
| Molecular Weight | 590.76 g/mol |
| Exact Mass | 590.32 |
| IUPAC Name | 4-[(E)-3-[5-(1-adamantyl)-2-hexoxy-4-(2-methoxyethoxymethoxy)phenyl]-3-oxoprop-1-enyl]benzoic acid |
| SMILES | CCCCCCOc1cc(OCOCCOC)c(C23CC4CC(CC(C4)C2)C3)cc1C(=O)/C=C/c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C36H46O7/c1-3-4-5-6-13-42-33-20-34(43-24-41-15-14-40-2)31(36-21-26-16-27(22-36)18-28(17-26)23-36)19-30(33)32(37)12-9-25-7-10-29(11-8-25)35(38)39/h7-12,19-20,26-28H,3-6,13-18,21-24H2,1-2H3,(H,38,39)/b12-9+ |
| InChIKey | MZFKBANFPPESFA-FMIVXFBMSA-N |
| XLogP | 7.71 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.76 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|