C22H30O4 — CID 57060377
1-[4-(1-adamantyl)-3-(2-methoxyethoxymethoxy)phenyl]ethanone (PubChem CID 57060377) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is 1-[4-(1-adamantyl)-3-(2-methoxyethoxymethoxy)phenyl]ethanone.
| Compound Name | 1-[4-(1-adamantyl)-3-(2-methoxyethoxymethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 57060377 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 1-[4-(1-adamantyl)-3-(2-methoxyethoxymethoxy)phenyl]ethanone |
| SMILES | COCCOCOc1cc(C(C)=O)ccc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H30O4/c1-15(23)19-3-4-20(21(10-19)26-14-25-6-5-24-2)22-11-16-7-17(12-22)9-18(8-16)13-22/h3-4,10,16-18H,5-9,11-14H2,1-2H3 |
| InChIKey | DVHRMKZWWMWBLP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|