C30H36O5 — CID 67663589
3-[3-(1-adamantyl)-4-(2-methoxyethoxymethoxy)phenyl]prop-1-enyl benzoate (PubChem CID 67663589) has the molecular formula C30H36O5 and a molecular weight of 476.61 g/mol. Its IUPAC name is 3-[3-(1-adamantyl)-4-(2-methoxyethoxymethoxy)phenyl]prop-1-enyl benzoate.
| Compound Name | 3-[3-(1-adamantyl)-4-(2-methoxyethoxymethoxy)phenyl]prop-1-enyl benzoate |
|---|---|
| PubChem CID | 67663589 |
| Molecular Formula | C30H36O5 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | 3-[3-(1-adamantyl)-4-(2-methoxyethoxymethoxy)phenyl]prop-1-enyl benzoate |
| SMILES | COCCOCOc1ccc(CC=COC(=O)c2ccccc2)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C30H36O5/c1-32-12-13-33-21-35-28-10-9-22(6-5-11-34-29(31)26-7-3-2-4-8-26)17-27(28)30-18-23-14-24(19-30)16-25(15-23)20-30/h2-5,7-11,17,23-25H,6,12-16,18-21H2,1H3 |
| InChIKey | MDZVRNMXJIAQFS-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|