C33H39NO5 — CID 131719639
[4-[2-[3-(1-adamantyl)-4-(2-methoxyethoxymethoxy)phenyl]ethynyl]phenyl]-morpholin-4-ylmethanone (PubChem CID 131719639) has the molecular formula C33H39NO5 and a molecular weight of 529.68 g/mol. Its IUPAC name is [4-[2-[3-(1-adamantyl)-4-(2-methoxyethoxymethoxy)phenyl]ethynyl]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[2-[3-(1-adamantyl)-4-(2-methoxyethoxymethoxy)phenyl]ethynyl]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 131719639 |
| Molecular Formula | C33H39NO5 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | [4-[2-[3-(1-adamantyl)-4-(2-methoxyethoxymethoxy)phenyl]ethynyl]phenyl]-morpholin-4-ylmethanone |
| SMILES | COCCOCOc1ccc(C#Cc2ccc(C(=O)N3CCOCC3)cc2)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C33H39NO5/c1-36-14-15-38-23-39-31-9-6-25(19-30(31)33-20-26-16-27(21-33)18-28(17-26)22-33)3-2-24-4-7-29(8-5-24)32(35)34-10-12-37-13-11-34/h4-9,19,26-28H,10-18,20-23H2,1H3 |
| InChIKey | ZQWODGIZYJRWKC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|