C30H32O3 — CID 19063023
methyl 4-[2-[3-(1-adamantyl)-4-(cyclopropylmethoxy)phenyl]ethynyl]benzoate (PubChem CID 19063023) has the molecular formula C30H32O3 and a molecular weight of 440.58 g/mol. Its IUPAC name is methyl 4-[2-[3-(1-adamantyl)-4-(cyclopropylmethoxy)phenyl]ethynyl]benzoate.
| Compound Name | methyl 4-[2-[3-(1-adamantyl)-4-(cyclopropylmethoxy)phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 19063023 |
| Molecular Formula | C30H32O3 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | methyl 4-[2-[3-(1-adamantyl)-4-(cyclopropylmethoxy)phenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1ccc(C#Cc2ccc(OCC3CC3)c(C34CC5CC(CC(C5)C3)C4)c2)cc1 |
| InChI | InChI=1S/C30H32O3/c1-32-29(31)26-9-6-20(7-10-26)2-3-21-8-11-28(33-19-22-4-5-22)27(15-21)30-16-23-12-24(17-30)14-25(13-23)18-30/h6-11,15,22-25H,4-5,12-14,16-19H2,1H3 |
| InChIKey | IFSRJSLCWBPMHW-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|