C21H36N4O5 — CID 159220930
3-(1-adamantyl)-4-(2-methoxyethoxymethoxy)benzohydrazide;hydrazine;hydrate (PubChem CID 159220930) has the molecular formula C21H36N4O5 and a molecular weight of 424.54 g/mol. Its IUPAC name is 3-(1-adamantyl)-4-(2-methoxyethoxymethoxy)benzohydrazide;hydrazine;hydrate.
| Compound Name | 3-(1-adamantyl)-4-(2-methoxyethoxymethoxy)benzohydrazide;hydrazine;hydrate |
|---|---|
| PubChem CID | 159220930 |
| Molecular Formula | C21H36N4O5 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | 3-(1-adamantyl)-4-(2-methoxyethoxymethoxy)benzohydrazide;hydrazine;hydrate |
| SMILES | COCCOCOc1ccc(C(=O)NN)cc1C12CC3CC(CC(C3)C1)C2.NN.O |
| InChI | InChI=1S/C21H30N2O4.H4N2.H2O/c1-25-4-5-26-13-27-19-3-2-17(20(24)23-22)9-18(19)21-10-14-6-15(11-21)8-16(7-14)12-21;1-2;/h2-3,9,14-16H,4-8,10-13,22H2,1H3,(H,23,24);1-2H2;1H2 |
| InChIKey | DJYJTRUEQLAODH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 166.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|