C32H40O4 — CID 140637405
(E)-1-[3-(1-adamantyl)-4-(2-methoxyethoxymethoxy)phenyl]-3-(4-propan-2-ylphenyl)prop-2-en-1-one (PubChem CID 140637405) has the molecular formula C32H40O4 and a molecular weight of 488.67 g/mol. Its IUPAC name is (E)-1-[3-(1-adamantyl)-4-(2-methoxyethoxymethoxy)phenyl]-3-(4-propan-2-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[3-(1-adamantyl)-4-(2-methoxyethoxymethoxy)phenyl]-3-(4-propan-2-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 140637405 |
| Molecular Formula | C32H40O4 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | (E)-1-[3-(1-adamantyl)-4-(2-methoxyethoxymethoxy)phenyl]-3-(4-propan-2-ylphenyl)prop-2-en-1-one |
| SMILES | COCCOCOc1ccc(C(=O)/C=C/c2ccc(C(C)C)cc2)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C32H40O4/c1-22(2)27-7-4-23(5-8-27)6-10-30(33)28-9-11-31(36-21-35-13-12-34-3)29(17-28)32-18-24-14-25(19-32)16-26(15-24)20-32/h4-11,17,22,24-26H,12-16,18-21H2,1-3H3/b10-6+ |
| InChIKey | IEVHWRZPNVLPFL-UXBLZVDNSA-N |
| XLogP | 7.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|