C33H40O6 — CID 44561978
4-[(E)-3-[5-(1-adamantyl)-4-(2-methoxyethoxymethoxy)-2-propylphenyl]-3-oxoprop-1-enyl]benzoic acid (PubChem CID 44561978) has the molecular formula C33H40O6 and a molecular weight of 532.68 g/mol. Its IUPAC name is 4-[(E)-3-[5-(1-adamantyl)-4-(2-methoxyethoxymethoxy)-2-propylphenyl]-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 4-[(E)-3-[5-(1-adamantyl)-4-(2-methoxyethoxymethoxy)-2-propylphenyl]-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 44561978 |
| Molecular Formula | C33H40O6 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | 4-[(E)-3-[5-(1-adamantyl)-4-(2-methoxyethoxymethoxy)-2-propylphenyl]-3-oxoprop-1-enyl]benzoic acid |
| SMILES | CCCc1cc(OCOCCOC)c(C23CC4CC(CC(C4)C2)C3)cc1C(=O)/C=C/c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C33H40O6/c1-3-4-27-16-31(39-21-38-12-11-37-2)29(33-18-23-13-24(19-33)15-25(14-23)20-33)17-28(27)30(34)10-7-22-5-8-26(9-6-22)32(35)36/h5-10,16-17,23-25H,3-4,11-15,18-21H2,1-2H3,(H,35,36)/b10-7+ |
| InChIKey | DVBMKBJJLNHAKK-JXMROGBWSA-N |
| XLogP | 6.70 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|