C32H40O3 — CID 67584296
4-[2-[4-(1-adamantyl)-3-heptoxyphenyl]ethenyl]benzoic acid (PubChem CID 67584296) has the molecular formula C32H40O3 and a molecular weight of 472.67 g/mol. Its IUPAC name is 4-[2-[4-(1-adamantyl)-3-heptoxyphenyl]ethenyl]benzoic acid.
| Compound Name | 4-[2-[4-(1-adamantyl)-3-heptoxyphenyl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 67584296 |
| Molecular Formula | C32H40O3 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | 4-[2-[4-(1-adamantyl)-3-heptoxyphenyl]ethenyl]benzoic acid |
| SMILES | CCCCCCCOc1cc(C=Cc2ccc(C(=O)O)cc2)ccc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C32H40O3/c1-2-3-4-5-6-15-35-30-19-24(8-7-23-9-12-28(13-10-23)31(33)34)11-14-29(30)32-20-25-16-26(21-32)18-27(17-25)22-32/h7-14,19,25-27H,2-6,15-18,20-22H2,1H3,(H,33,34) |
| InChIKey | AXBQORMADCRJGM-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|