C27H41NO3 — CID 44759498
N-(1-adamantyl)-3,4-dipentoxybenzamide (PubChem CID 44759498) has the molecular formula C27H41NO3 and a molecular weight of 427.63 g/mol. Its IUPAC name is N-(1-adamantyl)-3,4-dipentoxybenzamide.
| Compound Name | N-(1-adamantyl)-3,4-dipentoxybenzamide |
|---|---|
| PubChem CID | 44759498 |
| Molecular Formula | C27H41NO3 |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 427.31 |
| IUPAC Name | N-(1-adamantyl)-3,4-dipentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)NC23CC4CC(CC(C4)C2)C3)cc1OCCCCC |
| InChI | InChI=1S/C27H41NO3/c1-3-5-7-11-30-24-10-9-23(16-25(24)31-12-8-6-4-2)26(29)28-27-17-20-13-21(18-27)15-22(14-20)19-27/h9-10,16,20-22H,3-8,11-15,17-19H2,1-2H3,(H,28,29) |
| InChIKey | HFKUEIGQGFOOAQ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|