C22H36O3 — CID 23127596
1-(3,4-diheptoxyphenyl)ethanone (PubChem CID 23127596) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is 1-(3,4-diheptoxyphenyl)ethanone.
| Compound Name | 1-(3,4-diheptoxyphenyl)ethanone |
|---|---|
| PubChem CID | 23127596 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | 1-(3,4-diheptoxyphenyl)ethanone |
| SMILES | CCCCCCCOc1ccc(C(C)=O)cc1OCCCCCCC |
| InChI | InChI=1S/C22H36O3/c1-4-6-8-10-12-16-24-21-15-14-20(19(3)23)18-22(21)25-17-13-11-9-7-5-2/h14-15,18H,4-13,16-17H2,1-3H3 |
| InChIKey | QLQRRJSCWOYQJR-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|