C24H41NO3 — CID 170860475
2-amino-1-(3,4-dioctoxyphenyl)ethanone (PubChem CID 170860475) has the molecular formula C24H41NO3 and a molecular weight of 391.60 g/mol. Its IUPAC name is 2-amino-1-(3,4-dioctoxyphenyl)ethanone.
| Compound Name | 2-amino-1-(3,4-dioctoxyphenyl)ethanone |
|---|---|
| PubChem CID | 170860475 |
| Molecular Formula | C24H41NO3 |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.31 |
| IUPAC Name | 2-amino-1-(3,4-dioctoxyphenyl)ethanone |
| SMILES | CCCCCCCCOc1ccc(C(=O)CN)cc1OCCCCCCCC |
| InChI | InChI=1S/C24H41NO3/c1-3-5-7-9-11-13-17-27-23-16-15-21(22(26)20-25)19-24(23)28-18-14-12-10-8-6-4-2/h15-16,19H,3-14,17-18,20,25H2,1-2H3 |
| InChIKey | JZCDFBUTNASIFG-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|