C53H88O7 — CID 102189036
1-(3,4-didecoxyphenyl)-3-(3,4,5-trihexoxyphenyl)propane-1,3-dione (PubChem CID 102189036) has the molecular formula C53H88O7 and a molecular weight of 837.28 g/mol. Its IUPAC name is 1-(3,4-didecoxyphenyl)-3-(3,4,5-trihexoxyphenyl)propane-1,3-dione.
| Compound Name | 1-(3,4-didecoxyphenyl)-3-(3,4,5-trihexoxyphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 102189036 |
| Molecular Formula | C53H88O7 |
| Molecular Weight | 837.28 g/mol |
| Exact Mass | 836.65 |
| IUPAC Name | 1-(3,4-didecoxyphenyl)-3-(3,4,5-trihexoxyphenyl)propane-1,3-dione |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)CC(=O)c2cc(OCCCCCC)c(OCCCCCC)c(OCCCCCC)c2)cc1OCCCCCCCCCC |
| InChI | InChI=1S/C53H88O7/c1-6-11-16-21-23-25-27-32-36-56-49-35-34-45(41-50(49)57-37-33-28-26-24-22-17-12-7-2)47(54)44-48(55)46-42-51(58-38-29-18-13-8-3)53(60-40-31-20-15-10-5)52(43-46)59-39-30-19-14-9-4/h34-35,41-43H,6-33,36-40,44H2,1-5H3 |
| InChIKey | PFTAUNUJDOCAPZ-UHFFFAOYSA-N |
| XLogP | 16.06 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.28 |
| LogP ≤ 5 | 16.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|