C20H33NO3 — CID 3575779
3,4-dipentoxy-N-propan-2-ylbenzamide (PubChem CID 3575779) has the molecular formula C20H33NO3 and a molecular weight of 335.49 g/mol. Its IUPAC name is 3,4-dipentoxy-N-propan-2-ylbenzamide.
| Compound Name | 3,4-dipentoxy-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 3575779 |
| Molecular Formula | C20H33NO3 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | 3,4-dipentoxy-N-propan-2-ylbenzamide |
| SMILES | CCCCCOc1ccc(C(=O)NC(C)C)cc1OCCCCC |
| InChI | InChI=1S/C20H33NO3/c1-5-7-9-13-23-18-12-11-17(20(22)21-16(3)4)15-19(18)24-14-10-8-6-2/h11-12,15-16H,5-10,13-14H2,1-4H3,(H,21,22) |
| InChIKey | QIYWJGUXFPBRTG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|