C19H33NO3S — CID 143814342
3-(3-methoxypropoxy)-N-propan-2-yl-4-sulfanylbenzamide;2-methylbutane (PubChem CID 143814342) has the molecular formula C19H33NO3S and a molecular weight of 355.54 g/mol. Its IUPAC name is 3-(3-methoxypropoxy)-N-propan-2-yl-4-sulfanylbenzamide;2-methylbutane.
| Compound Name | 3-(3-methoxypropoxy)-N-propan-2-yl-4-sulfanylbenzamide;2-methylbutane |
|---|---|
| PubChem CID | 143814342 |
| Molecular Formula | C19H33NO3S |
| Molecular Weight | 355.54 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | 3-(3-methoxypropoxy)-N-propan-2-yl-4-sulfanylbenzamide;2-methylbutane |
| SMILES | CCC(C)C.COCCCOc1cc(C(=O)NC(C)C)ccc1S |
| InChI | InChI=1S/C14H21NO3S.C5H12/c1-10(2)15-14(16)11-5-6-13(19)12(9-11)18-8-4-7-17-3;1-4-5(2)3/h5-6,9-10,19H,4,7-8H2,1-3H3,(H,15,16);5H,4H2,1-3H3 |
| InChIKey | OMNRWNBUAMGTSH-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|