C23H28FN3O4 — CID 143814324
4-[5-(1-aminoethylidenecarbamoyl)-2-fluorophenyl]-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide (PubChem CID 143814324) has the molecular formula C23H28FN3O4 and a molecular weight of 429.49 g/mol. Its IUPAC name is 4-[5-(1-aminoethylidenecarbamoyl)-2-fluorophenyl]-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide.
| Compound Name | 4-[5-(1-aminoethylidenecarbamoyl)-2-fluorophenyl]-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 143814324 |
| Molecular Formula | C23H28FN3O4 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 4-[5-(1-aminoethylidenecarbamoyl)-2-fluorophenyl]-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide |
| SMILES | COCCCOc1cc(C(=O)NC(C)C)ccc1-c1cc(C(=O)/N=C(\C)N)ccc1F |
| InChI | InChI=1S/C23H28FN3O4/c1-14(2)26-22(28)17-6-8-18(21(13-17)31-11-5-10-30-4)19-12-16(7-9-20(19)24)23(29)27-15(3)25/h6-9,12-14H,5,10-11H2,1-4H3,(H,26,28)(H2,25,27,29) |
| InChIKey | JHENQUNTUQALSB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|