C30H35FN2O3 — CID 143814287
4-[2-fluoro-5-(2-phenylethyl)phenyl]-3-(3-methoxypropoxy)-N-piperidin-3-ylbenzamide (PubChem CID 143814287) has the molecular formula C30H35FN2O3 and a molecular weight of 490.62 g/mol. Its IUPAC name is 4-[2-fluoro-5-(2-phenylethyl)phenyl]-3-(3-methoxypropoxy)-N-piperidin-3-ylbenzamide.
| Compound Name | 4-[2-fluoro-5-(2-phenylethyl)phenyl]-3-(3-methoxypropoxy)-N-piperidin-3-ylbenzamide |
|---|---|
| PubChem CID | 143814287 |
| Molecular Formula | C30H35FN2O3 |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | 4-[2-fluoro-5-(2-phenylethyl)phenyl]-3-(3-methoxypropoxy)-N-piperidin-3-ylbenzamide |
| SMILES | COCCCOc1cc(C(=O)NC2CCCNC2)ccc1-c1cc(CCc2ccccc2)ccc1F |
| InChI | InChI=1S/C30H35FN2O3/c1-35-17-6-18-36-29-20-24(30(34)33-25-9-5-16-32-21-25)13-14-26(29)27-19-23(12-15-28(27)31)11-10-22-7-3-2-4-8-22/h2-4,7-8,12-15,19-20,25,32H,5-6,9-11,16-18,21H2,1H3,(H,33,34) |
| InChIKey | VHBZVYPWHDMBAO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|