C16H23N3O4 — CID 119425199
3-methoxy-4-[2-(methylamino)-2-oxoethoxy]-N-piperidin-3-ylbenzamide (PubChem CID 119425199) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is 3-methoxy-4-[2-(methylamino)-2-oxoethoxy]-N-piperidin-3-ylbenzamide.
| Compound Name | 3-methoxy-4-[2-(methylamino)-2-oxoethoxy]-N-piperidin-3-ylbenzamide |
|---|---|
| PubChem CID | 119425199 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 3-methoxy-4-[2-(methylamino)-2-oxoethoxy]-N-piperidin-3-ylbenzamide |
| SMILES | CNC(=O)COc1ccc(C(=O)NC2CCCNC2)cc1OC |
| InChI | InChI=1S/C16H23N3O4/c1-17-15(20)10-23-13-6-5-11(8-14(13)22-2)16(21)19-12-4-3-7-18-9-12/h5-6,8,12,18H,3-4,7,9-10H2,1-2H3,(H,17,20)(H,19,21) |
| InChIKey | NSZCYJNIRBYYBL-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |