C15H19N3O3 — CID 177120927
4-isocyano-3,5-dimethoxy-N-piperidin-3-ylbenzamide (PubChem CID 177120927) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 4-isocyano-3,5-dimethoxy-N-piperidin-3-ylbenzamide.
| Compound Name | 4-isocyano-3,5-dimethoxy-N-piperidin-3-ylbenzamide |
|---|---|
| PubChem CID | 177120927 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 4-isocyano-3,5-dimethoxy-N-piperidin-3-ylbenzamide |
| SMILES | [C-]#[N+]c1c(OC)cc(C(=O)NC2CCCNC2)cc1OC |
| InChI | InChI=1S/C15H19N3O3/c1-16-14-12(20-2)7-10(8-13(14)21-3)15(19)18-11-5-4-6-17-9-11/h7-8,11,17H,4-6,9H2,2-3H3,(H,18,19) |
| InChIKey | SYOAZFOVKGLPLF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 63.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|