C18H27FN2O5 — CID 159864662
tert-butyl N-[(3R)-piperidin-3-yl]carbamate;4-fluoro-3-methoxybenzoic acid (PubChem CID 159864662) has the molecular formula C18H27FN2O5 and a molecular weight of 370.42 g/mol. Its IUPAC name is tert-butyl N-[(3R)-piperidin-3-yl]carbamate;4-fluoro-3-methoxybenzoic acid.
| Compound Name | tert-butyl N-[(3R)-piperidin-3-yl]carbamate;4-fluoro-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 159864662 |
| Molecular Formula | C18H27FN2O5 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | tert-butyl N-[(3R)-piperidin-3-yl]carbamate;4-fluoro-3-methoxybenzoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCNC1.COc1cc(C(=O)O)ccc1F |
| InChI | InChI=1S/C10H20N2O2.C8H7FO3/c1-10(2,3)14-9(13)12-8-5-4-6-11-7-8;1-12-7-4-5(8(10)11)2-3-6(7)9/h8,11H,4-7H2,1-3H3,(H,12,13);2-4H,1H3,(H,10,11)/t8-;/m1./s1 |
| InChIKey | NROTUGJNMOSSKG-DDWIOCJRSA-N |
| XLogP | 2.80 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |