About tert-butyl N-[(3R)-piperidin-3-yl]carbamate;4-fluoro-3-methoxybenzoic acid
tert-butyl N-[(3R)-piperidin-3-yl]carbamate;4-fluoro-3-methoxybenzoic acid (PubChem CID 159864662) has the molecular formula C18H27FN2O5
and a molecular weight of 370.42 g/mol. Its IUPAC name is tert-butyl N-[(3R)-piperidin-3-yl]carbamate;4-fluoro-3-methoxybenzoic acid.
Molecular Properties
| Compound Name | tert-butyl N-[(3R)-piperidin-3-yl]carbamate;4-fluoro-3-methoxybenzoic acid |
| PubChem CID | 159864662 |
| Molecular Formula | C18H27FN2O5 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | tert-butyl N-[(3R)-piperidin-3-yl]carbamate;4-fluoro-3-methoxybenzoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCNC1.COc1cc(C(=O)O)ccc1F |
| InChI | InChI=1S/C10H20N2O2.C8H7FO3/c1-10(2,3)14-9(13)12-8-5-4-6-11-7-8;1-12-7-4-5(8(10)11)2-3-6(7)9/h8,11H,4-7H2,1-3H3,(H,12,13);2-4H,1H3,(H,10,11)/t8-;/m1./s1 |
| InChIKey | NROTUGJNMOSSKG-DDWIOCJRSA-N |
| XLogP | 2.80 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[(3R)-piperidin-3-yl]carbamate;4-fluoro-3-methoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(3R)-piperidin-3-yl]carbamate;4-fluoro-3-methoxybenzoic acid?
The IUPAC name of tert-butyl N-[(3R)-piperidin-3-yl]carbamate;4-fluoro-3-methoxybenzoic acid (CID 159864662) is tert-butyl N-[(3R)-piperidin-3-yl]carbamate;4-fluoro-3-methoxybenzoic acid.
What is the SMILES notation for tert-butyl N-[(3R)-piperidin-3-yl]carbamate;4-fluoro-3-methoxybenzoic acid?
The canonical SMILES for tert-butyl N-[(3R)-piperidin-3-yl]carbamate;4-fluoro-3-methoxybenzoic acid is CC(C)(C)OC(=O)N[C@@H]1CCCNC1.COc1cc(C(=O)O)ccc1F.
What is the InChIKey of tert-butyl N-[(3R)-piperidin-3-yl]carbamate;4-fluoro-3-methoxybenzoic acid?
The InChIKey is NROTUGJNMOSSKG-DDWIOCJRSA-N. The full InChI is InChI=1S/C10H20N2O2.C8H7FO3/c1-10(2,3)14-9(13)12-8-5-4-6-11-7-8;1-12-7-4-5(8(10)11)2-3-6(7)9/h8,11H,4-7H2,1-3H3,(H,12,13);2-4H,1H3,(H,10,11)/t8-;/m1./s1.
What are the key properties of tert-butyl N-[(3R)-piperidin-3-yl]carbamate;4-fluoro-3-methoxybenzoic acid?
tert-butyl N-[(3R)-piperidin-3-yl]carbamate;4-fluoro-3-methoxybenzoic acid has a molecular weight of 370.42 g/mol, XLogP of 2.80, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(3R)-piperidin-3-yl]carbamate;4-fluoro-3-methoxybenzoic acid is sourced from PubChem (CID 159864662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).