C10H21N3O2 — CID 71023711
tert-butyl N-[[(3R)-piperidin-3-yl]amino]carbamate (PubChem CID 71023711) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is tert-butyl N-[[(3R)-piperidin-3-yl]amino]carbamate.
| Compound Name | tert-butyl N-[[(3R)-piperidin-3-yl]amino]carbamate |
|---|---|
| PubChem CID | 71023711 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | tert-butyl N-[[(3R)-piperidin-3-yl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN[C@@H]1CCCNC1 |
| InChI | InChI=1S/C10H21N3O2/c1-10(2,3)15-9(14)13-12-8-5-4-6-11-7-8/h8,11-12H,4-7H2,1-3H3,(H,13,14)/t8-/m1/s1 |
| InChIKey | QOBUCUTUULGTCS-MRVPVSSYSA-N |
| XLogP | 0.77 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|