C15H27N3O5 — CID 70113833
methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(piperidin-3-ylamino)butanoate (PubChem CID 70113833) has the molecular formula C15H27N3O5 and a molecular weight of 329.40 g/mol. Its IUPAC name is methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(piperidin-3-ylamino)butanoate.
| Compound Name | methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(piperidin-3-ylamino)butanoate |
|---|---|
| PubChem CID | 70113833 |
| Molecular Formula | C15H27N3O5 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(piperidin-3-ylamino)butanoate |
| SMILES | COC(=O)CC(NC(=O)OC(C)(C)C)C(=O)NC1CCCNC1 |
| InChI | InChI=1S/C15H27N3O5/c1-15(2,3)23-14(21)18-11(8-12(19)22-4)13(20)17-10-6-5-7-16-9-10/h10-11,16H,5-9H2,1-4H3,(H,17,20)(H,18,21) |
| InChIKey | MIPKUSGCOCGIOG-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |