C13H24N2O5Y-2 — CID 59932739
carbanide;methyl 4-(ethylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate;yttrium (PubChem CID 59932739) has the molecular formula C13H24N2O5Y-2 and a molecular weight of 377.25 g/mol. Its IUPAC name is carbanide;methyl 4-(ethylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate;yttrium.
| Compound Name | carbanide;methyl 4-(ethylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate;yttrium |
|---|---|
| PubChem CID | 59932739 |
| Molecular Formula | C13H24N2O5Y-2 |
| Molecular Weight | 377.25 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | carbanide;methyl 4-(ethylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate;yttrium |
| SMILES | C[CH-]NC(=O)C(CC(=O)OC)NC(=O)OC(C)(C)C.[CH3-].[Y] |
| InChI | InChI=1S/C12H21N2O5.CH3.Y/c1-6-13-10(16)8(7-9(15)18-5)14-11(17)19-12(2,3)4;;/h6,8H,7H2,1-5H3,(H,13,16)(H,14,17);1H3;/q2*-1; |
| InChIKey | YASAXSSRGWCETE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|