C13H20N2O5 — CID 46845659
methyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(prop-2-ynylamino)butanoate (PubChem CID 46845659) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is methyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(prop-2-ynylamino)butanoate.
| Compound Name | methyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(prop-2-ynylamino)butanoate |
|---|---|
| PubChem CID | 46845659 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | methyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(prop-2-ynylamino)butanoate |
| SMILES | C#CCNC(=O)[C@H](CC(=O)OC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H20N2O5/c1-6-7-14-11(17)9(8-10(16)19-5)15-12(18)20-13(2,3)4/h1,9H,7-8H2,2-5H3,(H,14,17)(H,15,18)/t9-/m0/s1 |
| InChIKey | UXPZZPXOQZULRG-VIFPVBQESA-N |
| XLogP | 0.19 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|