C22H34N4O6S2 — CID 102083181
tert-butyl N-[(2R)-3-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(prop-2-ynylamino)propyl]disulfanyl]-1-oxo-1-(prop-2-ynylamino)propan-2-yl]carbamate (PubChem CID 102083181) has the molecular formula C22H34N4O6S2 and a molecular weight of 514.67 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(prop-2-ynylamino)propyl]disulfanyl]-1-oxo-1-(prop-2-ynylamino)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-3-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(prop-2-ynylamino)propyl]disulfanyl]-1-oxo-1-(prop-2-ynylamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 102083181 |
| Molecular Formula | C22H34N4O6S2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | tert-butyl N-[(2R)-3-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(prop-2-ynylamino)propyl]disulfanyl]-1-oxo-1-(prop-2-ynylamino)propan-2-yl]carbamate |
| SMILES | C#CCNC(=O)[C@H](CSSC[C@H](NC(=O)OC(C)(C)C)C(=O)NCC#C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H34N4O6S2/c1-9-11-23-17(27)15(25-19(29)31-21(3,4)5)13-33-34-14-16(18(28)24-12-10-2)26-20(30)32-22(6,7)8/h1-2,15-16H,11-14H2,3-8H3,(H,23,27)(H,24,28)(H,25,29)(H,26,30)/t15-,16-/m0/s1 |
| InChIKey | YYRHEKVCUDWOHF-HOTGVXAUSA-N |
| XLogP | 1.65 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|