C10H20N2O6S — CID 59656916
tert-butyl N-[(2S)-1-(ethylamino)-1-oxo-3-(trioxidanylsulfanyl)propan-2-yl]carbamate (PubChem CID 59656916) has the molecular formula C10H20N2O6S and a molecular weight of 296.35 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(ethylamino)-1-oxo-3-(trioxidanylsulfanyl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(ethylamino)-1-oxo-3-(trioxidanylsulfanyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 59656916 |
| Molecular Formula | C10H20N2O6S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | tert-butyl N-[(2S)-1-(ethylamino)-1-oxo-3-(trioxidanylsulfanyl)propan-2-yl]carbamate |
| SMILES | CCNC(=O)[C@@H](CSOOO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H20N2O6S/c1-5-11-8(13)7(6-19-18-17-15)12-9(14)16-10(2,3)4/h7,15H,5-6H2,1-4H3,(H,11,13)(H,12,14)/t7-/m1/s1 |
| InChIKey | CGFPYXNKUWNHRA-SSDOTTSWSA-N |
| XLogP | 1.09 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|