C14H30N2O3 — CID 143423917
tert-butyl N-[1-(ethylamino)-3-methyl-1-oxobutan-2-yl]carbamate;ethane (PubChem CID 143423917) has the molecular formula C14H30N2O3 and a molecular weight of 274.40 g/mol. Its IUPAC name is tert-butyl N-[1-(ethylamino)-3-methyl-1-oxobutan-2-yl]carbamate;ethane.
| Compound Name | tert-butyl N-[1-(ethylamino)-3-methyl-1-oxobutan-2-yl]carbamate;ethane |
|---|---|
| PubChem CID | 143423917 |
| Molecular Formula | C14H30N2O3 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | tert-butyl N-[1-(ethylamino)-3-methyl-1-oxobutan-2-yl]carbamate;ethane |
| SMILES | CC.CCNC(=O)C(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C12H24N2O3.C2H6/c1-7-13-10(15)9(8(2)3)14-11(16)17-12(4,5)6;1-2/h8-9H,7H2,1-6H3,(H,13,15)(H,14,16);1-2H3 |
| InChIKey | HSXWECOCSJPVMM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |