C15H30N2O3 — CID 14850274
tert-butyl N-[3-methyl-1-(2-methylbutylamino)-1-oxobutan-2-yl]carbamate (PubChem CID 14850274) has the molecular formula C15H30N2O3 and a molecular weight of 286.42 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-1-(2-methylbutylamino)-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-1-(2-methylbutylamino)-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 14850274 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | tert-butyl N-[3-methyl-1-(2-methylbutylamino)-1-oxobutan-2-yl]carbamate |
| SMILES | CCC(C)CNC(=O)C(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C15H30N2O3/c1-8-11(4)9-16-13(18)12(10(2)3)17-14(19)20-15(5,6)7/h10-12H,8-9H2,1-7H3,(H,16,18)(H,17,19) |
| InChIKey | NKRZZAZLWOFCRA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |