C11H22N2O4 — CID 58935373
tert-butyl N-[(2S)-1-(2-hydroxyethylamino)-1-oxobutan-2-yl]carbamate (PubChem CID 58935373) has the molecular formula C11H22N2O4 and a molecular weight of 246.31 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(2-hydroxyethylamino)-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(2-hydroxyethylamino)-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 58935373 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | tert-butyl N-[(2S)-1-(2-hydroxyethylamino)-1-oxobutan-2-yl]carbamate |
| SMILES | CC[C@H](NC(=O)OC(C)(C)C)C(=O)NCCO |
| InChI | InChI=1S/C11H22N2O4/c1-5-8(9(15)12-6-7-14)13-10(16)17-11(2,3)4/h8,14H,5-7H2,1-4H3,(H,12,15)(H,13,16)/t8-/m0/s1 |
| InChIKey | OTBKETGWMCYXIL-QMMMGPOBSA-N |
| XLogP | 0.40 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |