C13H24N2O5 — CID 86588879
methyl (2S)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoylamino]propanoate (PubChem CID 86588879) has the molecular formula C13H24N2O5 and a molecular weight of 288.34 g/mol. Its IUPAC name is methyl (2S)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoylamino]propanoate.
| Compound Name | methyl (2S)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoylamino]propanoate |
|---|---|
| PubChem CID | 86588879 |
| Molecular Formula | C13H24N2O5 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | methyl (2S)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoylamino]propanoate |
| SMILES | CCC(NC(=O)OC(C)(C)C)C(=O)N[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C13H24N2O5/c1-7-9(15-12(18)20-13(3,4)5)10(16)14-8(2)11(17)19-6/h8-9H,7H2,1-6H3,(H,14,16)(H,15,18)/t8-,9?/m0/s1 |
| InChIKey | QBUXGLKITCCJLJ-IENPIDJESA-N |
| XLogP | 0.97 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |