C10H19NO4 — CID 141391128
methyl 2-[(1-deuterio-2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 141391128) has the molecular formula C10H19NO4 and a molecular weight of 218.27 g/mol. Its IUPAC name is methyl 2-[(1-deuterio-2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | methyl 2-[(1-deuterio-2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 141391128 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | methyl 2-[(1-deuterio-2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | [2H]CC(C)(C)OC(=O)NC(CC)C(=O)OC |
| InChI | InChI=1S/C10H19NO4/c1-6-7(8(12)14-5)11-9(13)15-10(2,3)4/h7H,6H2,1-5H3,(H,11,13)/i2D |
| InChIKey | RFNZPQBRSIZDHQ-VMNATFBRSA-N |
| XLogP | 1.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |