C14H25NO6S — CID 10830617
methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(2-methylpropan-2-yl)oxycarbonylsulfanyl]propanoate (PubChem CID 10830617) has the molecular formula C14H25NO6S and a molecular weight of 335.42 g/mol. Its IUPAC name is methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(2-methylpropan-2-yl)oxycarbonylsulfanyl]propanoate.
| Compound Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(2-methylpropan-2-yl)oxycarbonylsulfanyl]propanoate |
|---|---|
| PubChem CID | 10830617 |
| Molecular Formula | C14H25NO6S |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(2-methylpropan-2-yl)oxycarbonylsulfanyl]propanoate |
| SMILES | COC(=O)C(CSC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25NO6S/c1-13(2,3)20-11(17)15-9(10(16)19-7)8-22-12(18)21-14(4,5)6/h9H,8H2,1-7H3,(H,15,17) |
| InChIKey | GQLUWKUCVWCSHW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|