C12H16F7NO4S — CID 164682414
methyl 3-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 164682414) has the molecular formula C12H16F7NO4S and a molecular weight of 403.32 g/mol. Its IUPAC name is methyl 3-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl 3-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 164682414 |
| Molecular Formula | C12H16F7NO4S |
| Molecular Weight | 403.32 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | methyl 3-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC(=O)C(CSC(F)(F)C(F)(F)C(F)(F)F)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H16F7NO4S/c1-9(2,3)24-8(22)20-6(7(21)23-4)5-25-12(18,19)10(13,14)11(15,16)17/h6H,5H2,1-4H3,(H,20,22) |
| InChIKey | GBYNGOOEVSKSSK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|