C11H22NO7P — CID 10267444
methyl (2R)-3-dimethoxyphosphoryl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 10267444) has the molecular formula C11H22NO7P and a molecular weight of 311.27 g/mol. Its IUPAC name is methyl (2R)-3-dimethoxyphosphoryl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl (2R)-3-dimethoxyphosphoryl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 10267444 |
| Molecular Formula | C11H22NO7P |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | methyl (2R)-3-dimethoxyphosphoryl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC(=O)[C@H](CP(=O)(OC)OC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H22NO7P/c1-11(2,3)19-10(14)12-8(9(13)16-4)7-20(15,17-5)18-6/h8H,7H2,1-6H3,(H,12,14)/t8-/m0/s1 |
| InChIKey | NPSIZLQIYKXHDY-QMMMGPOBSA-N |
| XLogP | 1.54 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|