C14H25NO6 — CID 20792103
dimethyl 2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (PubChem CID 20792103) has the molecular formula C14H25NO6 and a molecular weight of 303.36 g/mol. Its IUPAC name is dimethyl 2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate.
| Compound Name | dimethyl 2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
|---|---|
| PubChem CID | 20792103 |
| Molecular Formula | C14H25NO6 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | dimethyl 2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| SMILES | COC(=O)C(CC(C)(C)C(=O)OC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25NO6/c1-13(2,3)21-12(18)15-9(10(16)19-6)8-14(4,5)11(17)20-7/h9H,8H2,1-7H3,(H,15,18) |
| InChIKey | QPJCUAHLKGQKOD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|