C10H19NO5S — CID 10912419
methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfinylpropanoate (PubChem CID 10912419) has the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. Its IUPAC name is methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfinylpropanoate.
| Compound Name | methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfinylpropanoate |
|---|---|
| PubChem CID | 10912419 |
| Molecular Formula | C10H19NO5S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfinylpropanoate |
| SMILES | COC(=O)[C@H](CS(C)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H19NO5S/c1-10(2,3)16-9(13)11-7(6-17(5)14)8(12)15-4/h7H,6H2,1-5H3,(H,11,13)/t7-,17?/m0/s1 |
| InChIKey | BZBIWAYMDHDMCM-ISJKBYAMSA-N |
| XLogP | 0.43 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |