C12H23NO5S — CID 162425774
methyl (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(methylsulfinylmethyl)butanoate (PubChem CID 162425774) has the molecular formula C12H23NO5S and a molecular weight of 293.39 g/mol. Its IUPAC name is methyl (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(methylsulfinylmethyl)butanoate.
| Compound Name | methyl (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(methylsulfinylmethyl)butanoate |
|---|---|
| PubChem CID | 162425774 |
| Molecular Formula | C12H23NO5S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | methyl (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(methylsulfinylmethyl)butanoate |
| SMILES | COC(=O)C(CS(C)=O)[C@@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H23NO5S/c1-8(13-11(15)18-12(2,3)4)9(7-19(6)16)10(14)17-5/h8-9H,7H2,1-6H3,(H,13,15)/t8-,9?,19?/m1/s1 |
| InChIKey | PRPKWVWNKNEADU-PEXBRIMZSA-N |
| XLogP | 1.07 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |