C12H23NO4S — CID 72673259
tert-butyl N-(4-methyl-1-methylsulfinyl-2-oxopentan-3-yl)carbamate (PubChem CID 72673259) has the molecular formula C12H23NO4S and a molecular weight of 277.39 g/mol. Its IUPAC name is tert-butyl N-(4-methyl-1-methylsulfinyl-2-oxopentan-3-yl)carbamate.
| Compound Name | tert-butyl N-(4-methyl-1-methylsulfinyl-2-oxopentan-3-yl)carbamate |
|---|---|
| PubChem CID | 72673259 |
| Molecular Formula | C12H23NO4S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | tert-butyl N-(4-methyl-1-methylsulfinyl-2-oxopentan-3-yl)carbamate |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)C(=O)CS(C)=O |
| InChI | InChI=1S/C12H23NO4S/c1-8(2)10(9(14)7-18(6)16)13-11(15)17-12(3,4)5/h8,10H,7H2,1-6H3,(H,13,15) |
| InChIKey | PXBLUIPVDXUHOL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |