C13H23NO5 — CID 72761181
methyl 5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxohexanoate (PubChem CID 72761181) has the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. Its IUPAC name is methyl 5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxohexanoate.
| Compound Name | methyl 5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxohexanoate |
|---|---|
| PubChem CID | 72761181 |
| Molecular Formula | C13H23NO5 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | methyl 5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxohexanoate |
| SMILES | COC(=O)CC(=O)C(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C13H23NO5/c1-8(2)11(9(15)7-10(16)18-6)14-12(17)19-13(3,4)5/h8,11H,7H2,1-6H3,(H,14,17) |
| InChIKey | DDNICKQGRHYVOS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|