C22H45N3O3 — CID 58260199
tert-butyl N-[13-(3-aminopropylamino)-2-methyl-4-oxotridecan-3-yl]carbamate (PubChem CID 58260199) has the molecular formula C22H45N3O3 and a molecular weight of 399.62 g/mol. Its IUPAC name is tert-butyl N-[13-(3-aminopropylamino)-2-methyl-4-oxotridecan-3-yl]carbamate.
| Compound Name | tert-butyl N-[13-(3-aminopropylamino)-2-methyl-4-oxotridecan-3-yl]carbamate |
|---|---|
| PubChem CID | 58260199 |
| Molecular Formula | C22H45N3O3 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.35 |
| IUPAC Name | tert-butyl N-[13-(3-aminopropylamino)-2-methyl-4-oxotridecan-3-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)C(=O)CCCCCCCCCNCCCN |
| InChI | InChI=1S/C22H45N3O3/c1-18(2)20(25-21(27)28-22(3,4)5)19(26)14-11-9-7-6-8-10-12-16-24-17-13-15-23/h18,20,24H,6-17,23H2,1-5H3,(H,25,27) |
| InChIKey | LGPLGGIOABOCCZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|