C21H43N3O3 — CID 58260342
tert-butyl N-[13-(3-aminopropylamino)-4-oxotridecyl]carbamate (PubChem CID 58260342) has the molecular formula C21H43N3O3 and a molecular weight of 385.59 g/mol. Its IUPAC name is tert-butyl N-[13-(3-aminopropylamino)-4-oxotridecyl]carbamate.
| Compound Name | tert-butyl N-[13-(3-aminopropylamino)-4-oxotridecyl]carbamate |
|---|---|
| PubChem CID | 58260342 |
| Molecular Formula | C21H43N3O3 |
| Molecular Weight | 385.59 g/mol |
| Exact Mass | 385.33 |
| IUPAC Name | tert-butyl N-[13-(3-aminopropylamino)-4-oxotridecyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)CCCCCCCCCNCCCN |
| InChI | InChI=1S/C21H43N3O3/c1-21(2,3)27-20(26)24-18-11-14-19(25)13-9-7-5-4-6-8-10-16-23-17-12-15-22/h23H,4-18,22H2,1-3H3,(H,24,26) |
| InChIKey | RNNPRDPQNPRZOY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|