C14H24FNO4 — CID 132580029
methyl (Z)-4-fluoro-6-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]hept-3-enoate (PubChem CID 132580029) has the molecular formula C14H24FNO4 and a molecular weight of 289.35 g/mol. Its IUPAC name is methyl (Z)-4-fluoro-6-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]hept-3-enoate.
| Compound Name | methyl (Z)-4-fluoro-6-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]hept-3-enoate |
|---|---|
| PubChem CID | 132580029 |
| Molecular Formula | C14H24FNO4 |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | methyl (Z)-4-fluoro-6-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]hept-3-enoate |
| SMILES | COC(=O)C/C=C(\F)C(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C14H24FNO4/c1-9(2)12(10(15)7-8-11(17)19-6)16-13(18)20-14(3,4)5/h7,9,12H,8H2,1-6H3,(H,16,18)/b10-7- |
| InChIKey | FTDINKPDKSVJPV-YFHOEESVSA-N |
| XLogP | 2.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |