C12H18F5NO3 — CID 10870883
tert-butyl N-[(3S)-5,5,6,6,6-pentafluoro-2-methyl-4-oxohexan-3-yl]carbamate (PubChem CID 10870883) has the molecular formula C12H18F5NO3 and a molecular weight of 319.27 g/mol. Its IUPAC name is tert-butyl N-[(3S)-5,5,6,6,6-pentafluoro-2-methyl-4-oxohexan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-5,5,6,6,6-pentafluoro-2-methyl-4-oxohexan-3-yl]carbamate |
|---|---|
| PubChem CID | 10870883 |
| Molecular Formula | C12H18F5NO3 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | tert-butyl N-[(3S)-5,5,6,6,6-pentafluoro-2-methyl-4-oxohexan-3-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H18F5NO3/c1-6(2)7(18-9(20)21-10(3,4)5)8(19)11(13,14)12(15,16)17/h6-7H,1-5H3,(H,18,20)/t7-/m0/s1 |
| InChIKey | VYRBLIMTJCHZGK-ZETCQYMHSA-N |
| XLogP | 3.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|