C14H23NO5 — CID 10613136
methyl (E,5S)-6-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxohept-2-enoate (PubChem CID 10613136) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is methyl (E,5S)-6-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxohept-2-enoate.
| Compound Name | methyl (E,5S)-6-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxohept-2-enoate |
|---|---|
| PubChem CID | 10613136 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | methyl (E,5S)-6-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxohept-2-enoate |
| SMILES | COC(=O)/C=C/C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C14H23NO5/c1-9(2)12(10(16)7-8-11(17)19-6)15-13(18)20-14(3,4)5/h7-9,12H,1-6H3,(H,15,18)/b8-7+/t12-/m0/s1 |
| InChIKey | UFXLUKKFLJPIKG-GUOLPTJISA-N |
| XLogP | 1.83 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|