C14H16F11NO4S — CID 132515379
methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfanyl)propanoate (PubChem CID 132515379) has the molecular formula C14H16F11NO4S and a molecular weight of 503.33 g/mol. Its IUPAC name is methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfanyl)propanoate.
| Compound Name | methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfanyl)propanoate |
|---|---|
| PubChem CID | 132515379 |
| Molecular Formula | C14H16F11NO4S |
| Molecular Weight | 503.33 g/mol |
| Exact Mass | 503.06 |
| IUPAC Name | methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfanyl)propanoate |
| SMILES | COC(=O)[C@H](CSC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H16F11NO4S/c1-9(2,3)30-8(28)26-6(7(27)29-4)5-31-14(24,25)12(19,20)10(15,16)11(17,18)13(21,22)23/h6H,5H2,1-4H3,(H,26,28)/t6-/m0/s1 |
| InChIKey | QOLWIKWRKMJWIE-LURJTMIESA-N |
| XLogP | 4.85 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.33 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|