C8H17NO3 — CID 141231064
(1-deuterio-2-methylpropan-2-yl) N-(1-hydroxypropyl)carbamate (PubChem CID 141231064) has the molecular formula C8H17NO3 and a molecular weight of 176.23 g/mol. Its IUPAC name is (1-deuterio-2-methylpropan-2-yl) N-(1-hydroxypropyl)carbamate.
| Compound Name | (1-deuterio-2-methylpropan-2-yl) N-(1-hydroxypropyl)carbamate |
|---|---|
| PubChem CID | 141231064 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 176.23 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | (1-deuterio-2-methylpropan-2-yl) N-(1-hydroxypropyl)carbamate |
| SMILES | [2H]CC(C)(C)OC(=O)NC(O)CC |
| InChI | InChI=1S/C8H17NO3/c1-5-6(10)9-7(11)12-8(2,3)4/h6,10H,5H2,1-4H3,(H,9,11)/i2D |
| InChIKey | KTMAYMHFKURUIC-VMNATFBRSA-N |
| XLogP | 1.24 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.23 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|