C8H17NO3S — CID 162390279
(1-deuterio-2-methylpropan-2-yl) N-[(2R)-1-hydroxy-3-sulfanylpropan-2-yl]carbamate (PubChem CID 162390279) has the molecular formula C8H17NO3S and a molecular weight of 208.30 g/mol. Its IUPAC name is (1-deuterio-2-methylpropan-2-yl) N-[(2R)-1-hydroxy-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | (1-deuterio-2-methylpropan-2-yl) N-[(2R)-1-hydroxy-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 162390279 |
| Molecular Formula | C8H17NO3S |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | (1-deuterio-2-methylpropan-2-yl) N-[(2R)-1-hydroxy-3-sulfanylpropan-2-yl]carbamate |
| SMILES | [2H]CC(C)(C)OC(=O)N[C@H](CO)CS |
| InChI | InChI=1S/C8H17NO3S/c1-8(2,3)12-7(11)9-6(4-10)5-13/h6,10,13H,4-5H2,1-3H3,(H,9,11)/t6-/m1/s1/i1D |
| InChIKey | QJZIPROEVNIIPZ-NYVQFQNYSA-N |
| XLogP | 0.80 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|