C10H21NO3S2 — CID 130826642
tert-butyl N-[(2S)-4-methylsulfinyl-1-sulfanylbutan-2-yl]carbamate (PubChem CID 130826642) has the molecular formula C10H21NO3S2 and a molecular weight of 267.42 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-methylsulfinyl-1-sulfanylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4-methylsulfinyl-1-sulfanylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 130826642 |
| Molecular Formula | C10H21NO3S2 |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | tert-butyl N-[(2S)-4-methylsulfinyl-1-sulfanylbutan-2-yl]carbamate |
| SMILES | CS(=O)CC[C@@H](CS)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H21NO3S2/c1-10(2,3)14-9(12)11-8(7-15)5-6-16(4)13/h8,15H,5-7H2,1-4H3,(H,11,12)/t8-,16?/m0/s1 |
| InChIKey | KQVKBDKZJVFQQB-UOCSPZAXSA-N |
| XLogP | 1.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|